Top Banner

Click here to load reader

ค ำชี้แจง · PDF file · 2016-03-31สารชีวโมเลกุล...

Mar 20, 2018

ReportDownload

Documents

phamdien

  • 1 2

    1. 5

    1 2 3 4 5

    2. 2 2 4

    3. 3.1 3.2 3.3 3.4 3.5 3.6 3.7 3.8 3.9 3.10 3.11 3.12

    4.

  • 2 2

    2

    1.

    2.

    3. 5-6

    4.

    5.

    6.

    7.

    8.

  • 3 2

    2

    1. 2 4 2.

    3. 2

    10 10 4.

    5.

    6. 2 10 10

    7. 80 3

  • 4 2

    2

    1. /

    2. - - - -

    3.

    4. 3

  • 5 2

    3

    3.1

    3.2

    1.

    2.

    3.

    4.

    5.

    3.2 .4-5-6

    3.2 .4-5-6

    3.2 .4-5-6

  • 6 2

    2

    1.

    2.

    3.

    4.

  • 7 2

    10

    ()

    1.

    .

    .

    .

    .

    2.

    (C)

    A

    B

    C

    D

    63

    -1

    70

    -5

    16

    16

    18

    18

    . B

    . A C

    . C

    . B D

    2

  • 8 2

    3. . . . .

    4. .

    .

    .

    .

    5. 15 C 3

    .

    .

    .

    .

    6.

    1.

    2.

    3.

    4.

    . 1 2

    . 2 3

    . 3 4

    . 4 1

  • 9 2

    7. + () ..X.. X

    .

    .

    .

    .

    8.

    .

    .

    .

    .

    9.

    .

    . (II)

    .

    .

    10.

    .

    .

    .

    .

  • 10 2

    1 : http://www.thaigoodview.com/node/93678?page=0,1

    (fat and oil) (lipid) (triglyceride) (C) (H) (O) (fatty acid) (glycerol) + 3 + 3 ( )

    1

    http://www.thaigoodview.com/node/93678?page=0,1

  • 11 2

    CH2 - OH

    CH - OH

    CH2 - OH

    + 3R - C - OHO

    CH2 - O

    CH - O

    CH2 - OO

    - C - R

    - C - RO

    - C - RO

    + 3H2O

    (fat) (oil)

  • 12 2

    1 ...................... 1.

    ...................... 2. (fat)

    ...................... 3. (lipid) (fat and oil)

    (triglyceride)

    ...................... 4. 1

    1

    ...................... 5. (oil)

    1

  • 13 2

    2 3 (fat) (oil) (triglyceride)

    1. ..................................................................................... 2.

    ................................................................... 3. ........................................................................... 4.

    ................................................................... 5.

    ...................................................................

  • 14 2

    2 (-COOH) (-R) 12-26 14, 16 18 (R) 2

    1. (saturated fatty acid) 4 24 CnH2n+1 COOH ( n = 2 ) R-CH2-CH2-COOH

    2

    ( fatty acid)

  • 15 2

    2. (unsaturated fatty acid) CnH2n-1 COOH ( n = 2 ) R-CH=CHCOOH 18 1 2 (essential fatty acids)

  • 16 2

    .

    (0C) butyric acid caprilic acid lauric acid myristic acid palmatic acid stearic acid arachidic acid

    CH3(CH2)2COOH CH3(CH2)6COOH CH3(CH2)10COOH CH3(CH2)12COOH CH3(CH2)14COOH CH3(CH2)16COOH CH3(CH2)18COOH

    -7.9 -

    44.2 53.9 63.1 69.6 76.5

    ,

    . palmitoleic acid oleic acid linoleic acid linolenic acid arachidonic acid

    CH3(CH2)5CH=CH(CH2)7COOH CH3(CH2)7CH=CH(CH2)7COOH CH3(CH2)4(CH=CHCH2)2(CH2)6COOH CH3CH2(CH=CHCH2)3(CH2)6COOH CH3(CH2)4(CH=CHCH2)4(CH2)2COOH

    -0.5 13.4 -5

    -11 149.5

    ,

    (cholesterol)

  • 17 2

    2.2

    : http://www.loveuhealthy.com/1290199 : http://www.ilikemassage.com/article/detail.php?id=72

    2.3

    : http://www.myfirstbrain.com/student_view.aspx?ID=35102

    http://www.loveuhealthy.com/1290199%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20http://www.loveuhealthy.com/1290199%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20

  • 18 2

    ................ 1.

    ................ 2.

    ................ 3.

    ................ 4.

    ................ 5.

    ................ 6.

    ................ 7.

    ................ 8.

    ................ 9.

    2

  • 19 2

    1. 2. 3.

    1. 10 2. 10 3. 10 4. 10 5. 10 6. 50 5 7. 1 8. 1 9. 1

    3

  • 20 2

    1. 10 50

    2.

    3. 1-2

    2.4

  • 21 2

    ............... ............................... .. ................................

    .................................................................... ...............................................

    1. 2. 3.

    1 ........................

    2 ........................

  • 22 2

    1. ................................................................................................................................................................................................................................................................................................................

    2. ........................................................................................................................................................ ........................................................................................................................................................

    3. ........................................................................................................................................................ ........................................................................................................................................................ ........................................................................................................................................................

    4. ........................................................................................................................................................ ........................................................................................................................................................ ........................................................................................................................................................

    5. ........................................................................................................................................................ ........................................................................................................................................................ ........................................................................................................................................................

    ........................................................................................................................................................ ............................................................................................................................................................................................................................................................................................................................................................................................................................................................................................................... ..................................................................................................................................................................... ..................................................................................................................................................................... .....................................................................................................................................................................

  • 23 2

    1.

    2. 3. (saponification

    reaction)

    4. (rancidity)

    5. (hydrolysis)

    +

    +

    3

  • 24 2

    : E C BHT